C27H37N2O2+ — CID 20762058
trimethyl-[4-[2-[7-(2-methylindol-1-yl)heptoxy]-2-oxoethyl]phenyl]azanium (PubChem CID 20762058) has the molecular formula C27H37N2O2+ and a molecular weight of 421.61 g/mol. Its IUPAC name is trimethyl-[4-[2-[7-(2-methylindol-1-yl)heptoxy]-2-oxoethyl]phenyl]azanium.
| Compound Name | trimethyl-[4-[2-[7-(2-methylindol-1-yl)heptoxy]-2-oxoethyl]phenyl]azanium |
|---|---|
| PubChem CID | 20762058 |
| Molecular Formula | C27H37N2O2+ |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | trimethyl-[4-[2-[7-(2-methylindol-1-yl)heptoxy]-2-oxoethyl]phenyl]azanium |
| SMILES | Cc1cc2ccccc2n1CCCCCCCOC(=O)Cc1ccc([N+](C)(C)C)cc1 |
| InChI | InChI=1S/C27H37N2O2/c1-22-20-24-12-8-9-13-26(24)28(22)18-10-6-5-7-11-19-31-27(30)21-23-14-16-25(17-15-23)29(2,3)4/h8-9,12-17,20H,5-7,10-11,18-19,21H2,1-4H3/q+1 |
| InChIKey | ZPQGCAKZLGUUOC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|