About 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol
2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol (PubChem CID 158123582) has the molecular formula C16H16N2O6
and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol |
| PubChem CID | 158123582 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol |
| SMILES | O=CCc1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1cccc(CCO)c1 |
| InChI | InChI=1S/C8H7NO3.C8H9NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12;10-5-4-7-2-1-3-8(6-7)9(11)12/h1-4,6H,5H2;1-3,6,10H,4-5H2 |
| InChIKey | FRWUREJKEGISCJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol?
The IUPAC name of 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol (CID 158123582) is 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol.
What is the SMILES notation for 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol?
The canonical SMILES for 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol is O=CCc1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1cccc(CCO)c1.
What is the InChIKey of 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol?
The InChIKey is FRWUREJKEGISCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.C8H9NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12;10-5-4-7-2-1-3-8(6-7)9(11)12/h1-4,6H,5H2;1-3,6,10H,4-5H2.
What are the key properties of 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol?
2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol has a molecular weight of 332.31 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)acetaldehyde;2-(3-nitrophenyl)ethanol is sourced from PubChem (CID 158123582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).