C10H15N3O2 — CID 13050183
4-(4-nitrophenyl)butane-1,2-diamine (PubChem CID 13050183) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-(4-nitrophenyl)butane-1,2-diamine.
| Compound Name | 4-(4-nitrophenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 13050183 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-(4-nitrophenyl)butane-1,2-diamine |
| SMILES | NCC(N)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H15N3O2/c11-7-9(12)4-1-8-2-5-10(6-3-8)13(14)15/h2-3,5-6,9H,1,4,7,11-12H2 |
| InChIKey | PQVVOCQCDZSHDB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|