C12H14N4O8 — CID 57008185
1-nitro-4-(3,5,6-trinitrohexyl)benzene (PubChem CID 57008185) has the molecular formula C12H14N4O8 and a molecular weight of 342.26 g/mol. Its IUPAC name is 1-nitro-4-(3,5,6-trinitrohexyl)benzene.
| Compound Name | 1-nitro-4-(3,5,6-trinitrohexyl)benzene |
|---|---|
| PubChem CID | 57008185 |
| Molecular Formula | C12H14N4O8 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-nitro-4-(3,5,6-trinitrohexyl)benzene |
| SMILES | O=[N+]([O-])CC(CC(CCc1ccc([N+](=O)[O-])cc1)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O8/c17-13(18)8-12(16(23)24)7-11(15(21)22)6-3-9-1-4-10(5-2-9)14(19)20/h1-2,4-5,11-12H,3,6-8H2 |
| InChIKey | XZYKLMGUFGBJTD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|