About (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate
(3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate (PubChem CID 175521219) has the molecular formula C20H17NO5S
and a molecular weight of 383.43 g/mol. Its IUPAC name is (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate.
Molecular Properties
| Compound Name | (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate |
| PubChem CID | 175521219 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(OS(=O)(=O)c2ccc(CCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C20H17NO5S/c22-21(23)18-7-4-8-19(15-18)26-27(24,25)20-13-11-17(12-14-20)10-9-16-5-2-1-3-6-16/h1-8,11-15H,9-10H2 |
| InChIKey | BDNGENDZXPNINU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate?
The IUPAC name of (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate (CID 175521219) is (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate.
What is the SMILES notation for (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate?
The canonical SMILES for (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate is O=[N+]([O-])c1cccc(OS(=O)(=O)c2ccc(CCc3ccccc3)cc2)c1.
What is the InChIKey of (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate?
The InChIKey is BDNGENDZXPNINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO5S/c22-21(23)18-7-4-8-19(15-18)26-27(24,25)20-13-11-17(12-14-20)10-9-16-5-2-1-3-6-16/h1-8,11-15H,9-10H2.
What are the key properties of (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate?
(3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate has a molecular weight of 383.43 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) 4-(2-phenylethyl)benzenesulfonate is sourced from PubChem (CID 175521219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).