About 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate
3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate (PubChem CID 89439653) has the molecular formula C19H24O6S2
and a molecular weight of 412.53 g/mol. Its IUPAC name is 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate |
| PubChem CID | 89439653 |
| Molecular Formula | C19H24O6S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate |
| SMILES | CCC(OS(=O)(=O)c1cccc(C)c1)C(C)OS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C19H24O6S2/c1-5-19(25-27(22,23)18-11-7-9-15(3)13-18)16(4)24-26(20,21)17-10-6-8-14(2)12-17/h6-13,16,19H,5H2,1-4H3 |
| InChIKey | HADQWIZMLWSKLK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate?
The IUPAC name of 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate (CID 89439653) is 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate.
What is the SMILES notation for 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate?
The canonical SMILES for 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate is CCC(OS(=O)(=O)c1cccc(C)c1)C(C)OS(=O)(=O)c1cccc(C)c1.
What is the InChIKey of 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate?
The InChIKey is HADQWIZMLWSKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O6S2/c1-5-19(25-27(22,23)18-11-7-9-15(3)13-18)16(4)24-26(20,21)17-10-6-8-14(2)12-17/h6-13,16,19H,5H2,1-4H3.
What are the key properties of 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate?
3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate has a molecular weight of 412.53 g/mol, XLogP of 3.58, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylphenyl)sulfonyloxypentan-2-yl 3-methylbenzenesulfonate is sourced from PubChem (CID 89439653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).