C17H23N3O4S — CID 19629024
methyl (Z)-2-cyano-3-[4-(dipropylsulfamoyl)anilino]prop-2-enoate (PubChem CID 19629024) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is methyl (Z)-2-cyano-3-[4-(dipropylsulfamoyl)anilino]prop-2-enoate.
| Compound Name | methyl (Z)-2-cyano-3-[4-(dipropylsulfamoyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 19629024 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl (Z)-2-cyano-3-[4-(dipropylsulfamoyl)anilino]prop-2-enoate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)OC)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-4-10-20(11-5-2)25(22,23)16-8-6-15(7-9-16)19-13-14(12-18)17(21)24-3/h6-9,13,19H,4-5,10-11H2,1-3H3/b14-13- |
| InChIKey | VRVDMFNNUVNUNB-YPKPFQOOSA-N |
| XLogP | 2.49 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|