C15H21Cl3N2O4S — CID 155678497
2,2,2-trichloroethyl N-[4-(dipropylsulfamoyl)phenyl]carbamate (PubChem CID 155678497) has the molecular formula C15H21Cl3N2O4S and a molecular weight of 431.77 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[4-(dipropylsulfamoyl)phenyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[4-(dipropylsulfamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 155678497 |
| Molecular Formula | C15H21Cl3N2O4S |
| Molecular Weight | 431.77 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 2,2,2-trichloroethyl N-[4-(dipropylsulfamoyl)phenyl]carbamate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H21Cl3N2O4S/c1-3-9-20(10-4-2)25(22,23)13-7-5-12(6-8-13)19-14(21)24-11-15(16,17)18/h5-8H,3-4,9-11H2,1-2H3,(H,19,21) |
| InChIKey | VDFDHESUAKVWNP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|