C24H32N2O5S — CID 4946832
2-phenylethyl 4-[4-(dipropylsulfamoyl)anilino]-4-oxobutanoate (PubChem CID 4946832) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-phenylethyl 4-[4-(dipropylsulfamoyl)anilino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[4-(dipropylsulfamoyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4946832 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-phenylethyl 4-[4-(dipropylsulfamoyl)anilino]-4-oxobutanoate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=O)CCC(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N2O5S/c1-3-17-26(18-4-2)32(29,30)22-12-10-21(11-13-22)25-23(27)14-15-24(28)31-19-16-20-8-6-5-7-9-20/h5-13H,3-4,14-19H2,1-2H3,(H,25,27) |
| InChIKey | CTLCIEGKZGCZKK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |