C23H24N4O6S — CID 54782879
2-phenylethyl 4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoate (PubChem CID 54782879) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is 2-phenylethyl 4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54782879 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-phenylethyl 4-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoate |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)CCC(=O)OCCc3ccccc3)cc2)ncn1 |
| InChI | InChI=1S/C23H24N4O6S/c1-32-22-15-20(24-16-25-22)27-34(30,31)19-9-7-18(8-10-19)26-21(28)11-12-23(29)33-14-13-17-5-3-2-4-6-17/h2-10,15-16H,11-14H2,1H3,(H,26,28)(H,24,25,27) |
| InChIKey | DVNWQGXKQCGONA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |