C27H31N5O7S2 — CID 4923292
3-phenylpropyl 5-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate (PubChem CID 4923292) has the molecular formula C27H31N5O7S2 and a molecular weight of 601.71 g/mol. Its IUPAC name is 3-phenylpropyl 5-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4923292 |
| Molecular Formula | C27H31N5O7S2 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | 3-phenylpropyl 5-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)CCCC(=O)OCCCc3ccccc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C27H31N5O7S2/c1-37-24-18-22(29-26(31-24)38-2)32-41(35,36)21-15-13-20(14-16-21)28-27(40)30-23(33)11-6-12-25(34)39-17-7-10-19-8-4-3-5-9-19/h3-5,8-9,13-16,18H,6-7,10-12,17H2,1-2H3,(H,29,31,32)(H2,28,30,33,40) |
| InChIKey | QMKWVJILIXXLFT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|