C18H19ClN4O5 — CID 108831050
ethyl 1-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108831050) has the molecular formula C18H19ClN4O5 and a molecular weight of 406.83 g/mol. Its IUPAC name is ethyl 1-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108831050 |
| Molecular Formula | C18H19ClN4O5 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | ethyl 1-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\Nc2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H19ClN4O5/c1-2-28-18(25)12-5-7-22(8-6-12)17(24)13(10-20)11-21-14-3-4-15(19)16(9-14)23(26)27/h3-4,9,11-12,21H,2,5-8H2,1H3/b13-11- |
| InChIKey | WJPRARCPGUGDMM-QBFSEMIESA-N |
| XLogP | 2.87 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|