C22H29N3O5 — CID 108831036
ethyl 1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108831036) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl 1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108831036 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | ethyl 1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\NC(C)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C22H29N3O5/c1-5-30-22(27)16-8-10-25(11-9-16)21(26)18(13-23)14-24-15(2)17-6-7-19(28-3)20(12-17)29-4/h6-7,12,14-16,24H,5,8-11H2,1-4H3/b18-14- |
| InChIKey | MIUQMJPUZNLMEJ-JXAWBTAJSA-N |
| XLogP | 2.56 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|