C18H23N5O3 — CID 108841480
(Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide (PubChem CID 108841480) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108841480 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-N-(1,3-benzodioxol-5-ylmethyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(CCN)CC1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H23N5O3/c19-3-4-22-5-7-23(8-6-22)12-15(10-20)18(24)21-11-14-1-2-16-17(9-14)26-13-25-16/h1-2,9,12H,3-8,11,13,19H2,(H,21,24)/b15-12- |
| InChIKey | IBEXTDIFYYPGPK-QINSGFPZSA-N |
| XLogP | 0.02 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|