C18H15Cl2N3O4 — CID 5230716
N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(2,4-dichlorophenyl)butanediamide (PubChem CID 5230716) has the molecular formula C18H15Cl2N3O4 and a molecular weight of 408.24 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(2,4-dichlorophenyl)butanediamide.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(2,4-dichlorophenyl)butanediamide |
|---|---|
| PubChem CID | 5230716 |
| Molecular Formula | C18H15Cl2N3O4 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(2,4-dichlorophenyl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Cl)cc1Cl)NN=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15Cl2N3O4/c19-12-2-3-14(13(20)8-12)22-17(24)5-6-18(25)23-21-9-11-1-4-15-16(7-11)27-10-26-15/h1-4,7-9H,5-6,10H2,(H,22,24)(H,23,25) |
| InChIKey | OGECIQZLJIDDTN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|