C24H23N2O4+ — CID 8545731
[2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-benzhydrylazanium (PubChem CID 8545731) has the molecular formula C24H23N2O4+ and a molecular weight of 403.46 g/mol. Its IUPAC name is [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-benzhydrylazanium.
| Compound Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-benzhydrylazanium |
|---|---|
| PubChem CID | 8545731 |
| Molecular Formula | C24H23N2O4+ |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-benzhydrylazanium |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)C[NH2+]C(c1ccccc1)c1ccccc1)OCO2 |
| InChI | InChI=1S/C24H22N2O4/c1-16(27)19-12-21-22(30-15-29-21)13-20(19)26-23(28)14-25-24(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,24-25H,14-15H2,1H3,(H,26,28)/p+1 |
| InChIKey | KQIGHOYRKCIWIA-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |