About N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide
N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide (PubChem CID 123171228) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide |
| PubChem CID | 123171228 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide |
| SMILES | Cc1ccccc1/N=C(\N=C\N)c1ccccc1 |
| InChI | InChI=1S/C15H15N3/c1-12-7-5-6-10-14(12)18-15(17-11-16)13-8-3-2-4-9-13/h2-11H,1H3,(H2,16,17,18) |
| InChIKey | KOFFUTDBJCLYTL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide?
The IUPAC name of N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide (CID 123171228) is N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide.
What is the SMILES notation for N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide?
The canonical SMILES for N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide is Cc1ccccc1/N=C(\N=C\N)c1ccccc1.
What is the InChIKey of N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide?
The InChIKey is KOFFUTDBJCLYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3/c1-12-7-5-6-10-14(12)18-15(17-11-16)13-8-3-2-4-9-13/h2-11H,1H3,(H2,16,17,18).
What are the key properties of N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide?
N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide has a molecular weight of 237.31 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(aminomethylidene)-N'-(2-methylphenyl)benzenecarboximidamide is sourced from PubChem (CID 123171228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).