C21H19N3O2 — CID 4779414
N,N'-bis(2-methylphenyl)-4-nitrobenzenecarboximidamide (PubChem CID 4779414) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is N,N'-bis(2-methylphenyl)-4-nitrobenzenecarboximidamide.
| Compound Name | N,N'-bis(2-methylphenyl)-4-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 4779414 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N,N'-bis(2-methylphenyl)-4-nitrobenzenecarboximidamide |
| SMILES | Cc1ccccc1/N=C(/Nc1ccccc1C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19N3O2/c1-15-7-3-5-9-19(15)22-21(23-20-10-6-4-8-16(20)2)17-11-13-18(14-12-17)24(25)26/h3-14H,1-2H3,(H,22,23) |
| InChIKey | RLJFMLWFTJSJAC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|