C28H30N6 — CID 160707040
1,2-bis(2-methylphenyl)guanidine;1,2-diphenylguanidine (PubChem CID 160707040) has the molecular formula C28H30N6 and a molecular weight of 450.59 g/mol. Its IUPAC name is 1,2-bis(2-methylphenyl)guanidine;1,2-diphenylguanidine.
| Compound Name | 1,2-bis(2-methylphenyl)guanidine;1,2-diphenylguanidine |
|---|---|
| PubChem CID | 160707040 |
| Molecular Formula | C28H30N6 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1,2-bis(2-methylphenyl)guanidine;1,2-diphenylguanidine |
| SMILES | Cc1ccccc1/N=C(\N)Nc1ccccc1C.N/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C15H17N3.C13H13N3/c1-11-7-3-5-9-13(11)17-15(16)18-14-10-6-4-8-12(14)2;14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h3-10H,1-2H3,(H3,16,17,18);1-10H,(H3,14,15,16) |
| InChIKey | RRJADYVGQRYLJK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|