C22H24N4 — CID 67749783
1-amino-1,2,3-tris(2-methylphenyl)guanidine (PubChem CID 67749783) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-amino-1,2,3-tris(2-methylphenyl)guanidine.
| Compound Name | 1-amino-1,2,3-tris(2-methylphenyl)guanidine |
|---|---|
| PubChem CID | 67749783 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-amino-1,2,3-tris(2-methylphenyl)guanidine |
| SMILES | Cc1ccccc1/N=C(\Nc1ccccc1C)N(N)c1ccccc1C |
| InChI | InChI=1S/C22H24N4/c1-16-10-4-7-13-19(16)24-22(25-20-14-8-5-11-17(20)2)26(23)21-15-9-6-12-18(21)3/h4-15H,23H2,1-3H3,(H,24,25) |
| InChIKey | KPZRNAFWTUTXLD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|