C19H20N6O2 — CID 29158251
2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-methylphenyl)acetamide (PubChem CID 29158251) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 29158251 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)C[C@@H]1N=C(N=C(N)Nc2ccccc2)NC1=O |
| InChI | InChI=1S/C19H20N6O2/c1-12-7-5-6-10-14(12)22-16(26)11-15-17(27)24-19(23-15)25-18(20)21-13-8-3-2-4-9-13/h2-10,15H,11H2,1H3,(H,22,26)(H4,20,21,23,24,25,27)/t15-/m0/s1 |
| InChIKey | AVKPXSXYRIQTLV-HNNXBMFYSA-N |
| XLogP | 1.60 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|