C20H22N6O2 — CID 17228827
2-[2-[(E)-[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 17228827) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-[2-[(E)-[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[2-[(E)-[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 17228827 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[2-[(E)-[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CC2N=C(/N=C(\N)Nc3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C20H22N6O2/c1-2-13-8-10-15(11-9-13)22-17(27)12-16-18(28)25-20(24-16)26-19(21)23-14-6-4-3-5-7-14/h3-11,16H,2,12H2,1H3,(H,22,27)(H4,21,23,24,25,26,28) |
| InChIKey | UJBUQXAHJYKYEX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|