C24H28N6O4 — CID 43841165
butyl 4-[[2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]benzoate (PubChem CID 43841165) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is butyl 4-[[2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43841165 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | butyl 4-[[2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CC2N=C(/N=C(\N)Nc3cccc(C)c3)NC2=O)cc1 |
| InChI | InChI=1S/C24H28N6O4/c1-3-4-12-34-22(33)16-8-10-17(11-9-16)26-20(31)14-19-21(32)29-24(28-19)30-23(25)27-18-7-5-6-15(2)13-18/h5-11,13,19H,3-4,12,14H2,1-2H3,(H,26,31)(H4,25,27,28,29,30,32) |
| InChIKey | PUAHORSTIOARJA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|