C20H21ClN6O2 — CID 43841157
2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(5-chloro-2-methylphenyl)acetamide (PubChem CID 43841157) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(5-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(5-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43841157 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[2-[(E)-[amino-(3-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(5-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1cccc(N/C(N)=N/C2=NC(CC(=O)Nc3cc(Cl)ccc3C)C(=O)N2)c1 |
| InChI | InChI=1S/C20H21ClN6O2/c1-11-4-3-5-14(8-11)23-19(22)27-20-25-16(18(29)26-20)10-17(28)24-15-9-13(21)7-6-12(15)2/h3-9,16H,10H2,1-2H3,(H,24,28)(H4,22,23,25,26,27,29) |
| InChIKey | LFZIWWJOAMANQZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|