C19H18Cl2N6O2 — CID 43841213
2-[2-[(E)-[amino-(2-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3,5-dichlorophenyl)acetamide (PubChem CID 43841213) has the molecular formula C19H18Cl2N6O2 and a molecular weight of 433.30 g/mol. Its IUPAC name is 2-[2-[(E)-[amino-(2-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-[2-[(E)-[amino-(2-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 43841213 |
| Molecular Formula | C19H18Cl2N6O2 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[2-[(E)-[amino-(2-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(3,5-dichlorophenyl)acetamide |
| SMILES | Cc1ccccc1N/C(N)=N/C1=NC(CC(=O)Nc2cc(Cl)cc(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C19H18Cl2N6O2/c1-10-4-2-3-5-14(10)24-18(22)27-19-25-15(17(29)26-19)9-16(28)23-13-7-11(20)6-12(21)8-13/h2-8,15H,9H2,1H3,(H,23,28)(H4,22,24,25,26,27,29) |
| InChIKey | ICFQPLKPXRBLDN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|