C22H26N6O2 — CID 43841256
2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 43841256) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43841256 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | Cc1ccc(N/C(N)=N/C2=NC(CC(=O)Nc3ccc(C(C)C)cc3)C(=O)N2)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-13(2)15-6-10-16(11-7-15)24-19(29)12-18-20(30)27-22(26-18)28-21(23)25-17-8-4-14(3)5-9-17/h4-11,13,18H,12H2,1-3H3,(H,24,29)(H4,23,25,26,27,28,30) |
| InChIKey | QUJBFKXZNSVDEY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|