C18H17N7O4 — CID 29044590
2-[(4R)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 29044590) has the molecular formula C18H17N7O4 and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-[(4R)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(4R)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 29044590 |
| Molecular Formula | C18H17N7O4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[(4R)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | NC(=NC1=N[C@H](CC(=O)Nc2ccc([N+](=O)[O-])cc2)C(=O)N1)Nc1ccccc1 |
| InChI | InChI=1S/C18H17N7O4/c19-17(21-11-4-2-1-3-5-11)24-18-22-14(16(27)23-18)10-15(26)20-12-6-8-13(9-7-12)25(28)29/h1-9,14H,10H2,(H,20,26)(H4,19,21,22,23,24,27)/t14-/m1/s1 |
| InChIKey | PCGSEVUGWTWAJO-CQSZACIVSA-N |
| XLogP | 1.20 |
| TPSA | 164.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|