C20H22N6O4 — CID 30465650
2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 30465650) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30465650 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[(4S)-2-[[amino(anilino)methylidene]amino]-5-oxo-1,4-dihydroimidazol-4-yl]-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[C@@H]2N=C(N=C(N)Nc3ccccc3)NC2=O)c(OC)c1 |
| InChI | InChI=1S/C20H22N6O4/c1-29-13-8-9-14(16(10-13)30-2)23-17(27)11-15-18(28)25-20(24-15)26-19(21)22-12-6-4-3-5-7-12/h3-10,15H,11H2,1-2H3,(H,23,27)(H4,21,22,24,25,26,28)/t15-/m0/s1 |
| InChIKey | OSVQXEWZXNDMGC-HNNXBMFYSA-N |
| XLogP | 1.31 |
| TPSA | 139.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|