C10H14N4OS — CID 77061102
[2-(2-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate (PubChem CID 77061102) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77061102 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate |
| SMILES | Cc1ccccc1NC(=O)CSC(N)=NN |
| InChI | InChI=1S/C10H14N4OS/c1-7-4-2-3-5-8(7)13-9(15)6-16-10(11)14-12/h2-5H,6,12H2,1H3,(H2,11,14)(H,13,15) |
| InChIKey | UFLQUAJMZCGAJJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|