C22H22N4O6S2 — CID 4304523
2-cyano-3-[[2-cyano-1-ethoxy-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]disulfanyl]-3-ethoxy-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 4304523) has the molecular formula C22H22N4O6S2 and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-cyano-3-[[2-cyano-1-ethoxy-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]disulfanyl]-3-ethoxy-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[[2-cyano-1-ethoxy-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]disulfanyl]-3-ethoxy-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 4304523 |
| Molecular Formula | C22H22N4O6S2 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2-cyano-3-[[2-cyano-1-ethoxy-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]disulfanyl]-3-ethoxy-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CCOC(SSC(OCC)=C(C#N)C(=O)NCc1ccco1)=C(C#N)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C22H22N4O6S2/c1-3-29-21(17(11-23)19(27)25-13-15-7-5-9-31-15)33-34-22(30-4-2)18(12-24)20(28)26-14-16-8-6-10-32-16/h5-10H,3-4,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | HJHMFVQDCVLQHX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|