C16H16N2O4 — CID 164625826
1-N-hydroxy-3-N-(2-phenylethoxy)benzene-1,3-dicarboxamide (PubChem CID 164625826) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-N-hydroxy-3-N-(2-phenylethoxy)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-hydroxy-3-N-(2-phenylethoxy)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 164625826 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-N-hydroxy-3-N-(2-phenylethoxy)benzene-1,3-dicarboxamide |
| SMILES | O=C(NO)c1cccc(C(=O)NOCCc2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O4/c19-15(17-21)13-7-4-8-14(11-13)16(20)18-22-10-9-12-5-2-1-3-6-12/h1-8,11,21H,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | IBZHCQSCIXOZAI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|