About sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid
sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid (PubChem CID 175726344) has the molecular formula C13H11N2NaO3
and a molecular weight of 266.23 g/mol. Its IUPAC name is sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid |
| PubChem CID | 175726344 |
| Molecular Formula | C13H11N2NaO3 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid |
| SMILES | Cc1ccccc1[C-]=O.O=C(O)c1cnccn1.[Na+] |
| InChI | InChI=1S/C8H7O.C5H4N2O2.Na/c1-7-4-2-3-5-8(7)6-9;8-5(9)4-3-6-1-2-7-4;/h2-5H,1H3;1-3H,(H,8,9);/q-1;;+1 |
| InChIKey | FCJUCHDDXWSKIH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid?
The IUPAC name of sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid (CID 175726344) is sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid.
What is the SMILES notation for sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid?
The canonical SMILES for sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid is Cc1ccccc1[C-]=O.O=C(O)c1cnccn1.[Na+].
What is the InChIKey of sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid?
The InChIKey is FCJUCHDDXWSKIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O.C5H4N2O2.Na/c1-7-4-2-3-5-8(7)6-9;8-5(9)4-3-6-1-2-7-4;/h2-5H,1H3;1-3H,(H,8,9);/q-1;;+1.
What are the key properties of sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid?
sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid has a molecular weight of 266.23 g/mol, XLogP of -1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(2-methylphenyl)methanone;pyrazine-2-carboxylic acid is sourced from PubChem (CID 175726344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).