About 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone
2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone (PubChem CID 105135828) has the molecular formula C12H9F2NOS
and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone |
| PubChem CID | 105135828 |
| Molecular Formula | C12H9F2NOS |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone |
| SMILES | Cc1ncsc1C(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H9F2NOS/c1-7-12(17-6-15-7)11(16)5-8-9(13)3-2-4-10(8)14/h2-4,6H,5H2,1H3 |
| InChIKey | CXMBRIURJGSLFO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone?
The IUPAC name of 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone (CID 105135828) is 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone is Cc1ncsc1C(=O)Cc1c(F)cccc1F.
What is the InChIKey of 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone?
The InChIKey is CXMBRIURJGSLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NOS/c1-7-12(17-6-15-7)11(16)5-8-9(13)3-2-4-10(8)14/h2-4,6H,5H2,1H3.
What are the key properties of 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone?
2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone has a molecular weight of 253.27 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-1-(4-methyl-1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 105135828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).