C11H6BrF2NOS — CID 161381380
1-(2-bromo-1,3-thiazol-5-yl)-2-(2,6-difluorophenyl)ethanone (PubChem CID 161381380) has the molecular formula C11H6BrF2NOS and a molecular weight of 318.14 g/mol. Its IUPAC name is 1-(2-bromo-1,3-thiazol-5-yl)-2-(2,6-difluorophenyl)ethanone.
| Compound Name | 1-(2-bromo-1,3-thiazol-5-yl)-2-(2,6-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 161381380 |
| Molecular Formula | C11H6BrF2NOS |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 1-(2-bromo-1,3-thiazol-5-yl)-2-(2,6-difluorophenyl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1F)c1cnc(Br)s1 |
| InChI | InChI=1S/C11H6BrF2NOS/c12-11-15-5-10(17-11)9(16)4-6-7(13)2-1-3-8(6)14/h1-3,5H,4H2 |
| InChIKey | VRTNQQPPRBDSPN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |