C10H8N2OS — CID 19956162
(2-amino-1,3-thiazol-5-yl)-phenylmethanone (PubChem CID 19956162) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-5-yl)-phenylmethanone.
| Compound Name | (2-amino-1,3-thiazol-5-yl)-phenylmethanone |
|---|---|
| PubChem CID | 19956162 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (2-amino-1,3-thiazol-5-yl)-phenylmethanone |
| SMILES | Nc1ncc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C10H8N2OS/c11-10-12-6-8(14-10)9(13)7-4-2-1-3-5-7/h1-6H,(H2,11,12) |
| InChIKey | AJOABURBJQMQOP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |