C10H14ClNOS — CID 103402961
N-butan-2-yl-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 103402961) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is N-butan-2-yl-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-butan-2-yl-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103402961 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-butan-2-yl-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1scc(C)c1Cl |
| InChI | InChI=1S/C10H14ClNOS/c1-4-7(3)12-10(13)9-8(11)6(2)5-14-9/h5,7H,4H2,1-3H3,(H,12,13) |
| InChIKey | OMXZHWUFMCWVFN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |