C9H9ClN2OS — CID 103401616
3-chloro-N-(1-cyanoethyl)-4-methylthiophene-2-carboxamide (PubChem CID 103401616) has the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. Its IUPAC name is 3-chloro-N-(1-cyanoethyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(1-cyanoethyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103401616 |
| Molecular Formula | C9H9ClN2OS |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 3-chloro-N-(1-cyanoethyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NC(C)C#N)c1Cl |
| InChI | InChI=1S/C9H9ClN2OS/c1-5-4-14-8(7(5)10)9(13)12-6(2)3-11/h4,6H,1-2H3,(H,12,13) |
| InChIKey | DBJIWKVYBKWHQZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |