C11H16ClNO3S — CID 103401856
3-chloro-N-(1,1-dimethoxypropan-2-yl)-4-methylthiophene-2-carboxamide (PubChem CID 103401856) has the molecular formula C11H16ClNO3S and a molecular weight of 277.77 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dimethoxypropan-2-yl)-4-methylthiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(1,1-dimethoxypropan-2-yl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103401856 |
| Molecular Formula | C11H16ClNO3S |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-chloro-N-(1,1-dimethoxypropan-2-yl)-4-methylthiophene-2-carboxamide |
| SMILES | COC(OC)C(C)NC(=O)c1scc(C)c1Cl |
| InChI | InChI=1S/C11H16ClNO3S/c1-6-5-17-9(8(6)12)10(14)13-7(2)11(15-3)16-4/h5,7,11H,1-4H3,(H,13,14) |
| InChIKey | AWEGKQMDWZXUCI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|