C10H13BrClNO2S — CID 106184622
N-(1-bromo-3-methoxypropan-2-yl)-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 106184622) has the molecular formula C10H13BrClNO2S and a molecular weight of 326.64 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 106184622 |
| Molecular Formula | C10H13BrClNO2S |
| Molecular Weight | 326.64 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | COCC(CBr)NC(=O)c1scc(C)c1Cl |
| InChI | InChI=1S/C10H13BrClNO2S/c1-6-5-16-9(8(6)12)10(14)13-7(3-11)4-15-2/h5,7H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | GANKKEUMCZTIHD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|