C10H9BrF3NO3 — CID 81339730
4-bromo-2-methoxy-N-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 81339730) has the molecular formula C10H9BrF3NO3 and a molecular weight of 328.08 g/mol. Its IUPAC name is 4-bromo-2-methoxy-N-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 4-bromo-2-methoxy-N-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 81339730 |
| Molecular Formula | C10H9BrF3NO3 |
| Molecular Weight | 328.08 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 4-bromo-2-methoxy-N-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | COc1cc(Br)ccc1C(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C10H9BrF3NO3/c1-17-8-4-6(11)2-3-7(8)9(16)15-18-5-10(12,13)14/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | HDPYXHSAIFMXEJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.08 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|