C13H18BrNO4 — CID 107865880
4-bromo-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methoxybenzamide (PubChem CID 107865880) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 4-bromo-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methoxybenzamide.
| Compound Name | 4-bromo-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 107865880 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-bromo-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methoxybenzamide |
| SMILES | CCC(CO)(CO)NC(=O)c1ccc(Br)cc1OC |
| InChI | InChI=1S/C13H18BrNO4/c1-3-13(7-16,8-17)15-12(18)10-5-4-9(14)6-11(10)19-2/h4-6,16-17H,3,7-8H2,1-2H3,(H,15,18) |
| InChIKey | BHMUICFRCGNZNT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |