C13H16Br2ClNO2 — CID 107867840
N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-chloro-2-methoxybenzamide (PubChem CID 107867840) has the molecular formula C13H16Br2ClNO2 and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-chloro-2-methoxybenzamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 107867840 |
| Molecular Formula | C13H16Br2ClNO2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-chloro-2-methoxybenzamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1ccc(Cl)cc1OC |
| InChI | InChI=1S/C13H16Br2ClNO2/c1-3-13(7-14,8-15)17-12(18)10-5-4-9(16)6-11(10)19-2/h4-6H,3,7-8H2,1-2H3,(H,17,18) |
| InChIKey | UEKSIFJXDVBYCG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|