C11H9Cl2F3O2 — CID 43799481
1-(2,4-dichlorophenyl)-2-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 43799481) has the molecular formula C11H9Cl2F3O2 and a molecular weight of 301.09 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 43799481 |
| Molecular Formula | C11H9Cl2F3O2 |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CC(OCC(F)(F)F)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2F3O2/c1-6(18-5-11(14,15)16)10(17)8-3-2-7(12)4-9(8)13/h2-4,6H,5H2,1H3 |
| InChIKey | ZQJCRUVCBGKSTJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |