C13H13ClN4O2 — CID 3099406
2-[[(3-chloropyrazin-2-yl)hydrazinylidene]methyl]-5-ethoxyphenol (PubChem CID 3099406) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 2-[[(3-chloropyrazin-2-yl)hydrazinylidene]methyl]-5-ethoxyphenol.
| Compound Name | 2-[[(3-chloropyrazin-2-yl)hydrazinylidene]methyl]-5-ethoxyphenol |
|---|---|
| PubChem CID | 3099406 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[[(3-chloropyrazin-2-yl)hydrazinylidene]methyl]-5-ethoxyphenol |
| SMILES | CCOc1ccc(C=NNc2nccnc2Cl)c(O)c1 |
| InChI | InChI=1S/C13H13ClN4O2/c1-2-20-10-4-3-9(11(19)7-10)8-17-18-13-12(14)15-5-6-16-13/h3-8,19H,2H2,1H3,(H,16,18) |
| InChIKey | WOERLMPVRALDCC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|