C14H11Cl2N3O2S — CID 135716635
2-[(4,5-dichloro-2-pyridinyl)sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135716635) has the molecular formula C14H11Cl2N3O2S and a molecular weight of 356.23 g/mol. Its IUPAC name is 2-[(4,5-dichloro-2-pyridinyl)sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4,5-dichloro-2-pyridinyl)sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135716635 |
| Molecular Formula | C14H11Cl2N3O2S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 2-[(4,5-dichloro-2-pyridinyl)sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1cc(Cl)c(Cl)cn1)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C14H11Cl2N3O2S/c15-10-5-14(17-7-11(10)16)22-8-13(21)19-18-6-9-3-1-2-4-12(9)20/h1-7,20H,8H2,(H,19,21)/b18-6+ |
| InChIKey | DIVDEEHCBHQADN-NGYBGAFCSA-N |
| XLogP | 3.34 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|