C23H20ClN4O2S+ — CID 135632126
2-[[3-[(2-chlorophenyl)methyl]-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135632126) has the molecular formula C23H20ClN4O2S+ and a molecular weight of 451.96 g/mol. Its IUPAC name is 2-[[3-[(2-chlorophenyl)methyl]-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[3-[(2-chlorophenyl)methyl]-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135632126 |
| Molecular Formula | C23H20ClN4O2S+ |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-[[3-[(2-chlorophenyl)methyl]-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1[nH]c2ccccc2[n+]1Cc1ccccc1Cl)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C23H19ClN4O2S/c24-18-9-3-1-8-17(18)14-28-20-11-5-4-10-19(20)26-23(28)31-15-22(30)27-25-13-16-7-2-6-12-21(16)29/h1-13H,14-15H2,(H2,25,27,29,30)/p+1 |
| InChIKey | SFTXSYGVUQVLHU-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|