C19H22BrN3O2 — CID 4627721
2-(2-bromo-4-ethylphenoxy)-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide (PubChem CID 4627721) has the molecular formula C19H22BrN3O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is 2-(2-bromo-4-ethylphenoxy)-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-ethylphenoxy)-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4627721 |
| Molecular Formula | C19H22BrN3O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 2-(2-bromo-4-ethylphenoxy)-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CCc1ccc(OCC(=O)NN=Cc2ccc(N(C)C)cc2)c(Br)c1 |
| InChI | InChI=1S/C19H22BrN3O2/c1-4-14-7-10-18(17(20)11-14)25-13-19(24)22-21-12-15-5-8-16(9-6-15)23(2)3/h5-12H,4,13H2,1-3H3,(H,22,24) |
| InChIKey | QMICYZLDSBJFNT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|