C19H21Br2N3O2 — CID 5089742
2-(2,4-dibromophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide (PubChem CID 5089742) has the molecular formula C19H21Br2N3O2 and a molecular weight of 483.20 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5089742 |
| Molecular Formula | C19H21Br2N3O2 |
| Molecular Weight | 483.20 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)COc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C19H21Br2N3O2/c1-3-24(4-2)16-8-5-14(6-9-16)12-22-23-19(25)13-26-18-10-7-15(20)11-17(18)21/h5-12H,3-4,13H2,1-2H3,(H,23,25) |
| InChIKey | JFLVRBGXXOJGRY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|