C22H19BrCl2N2O — CID 110841024
N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline (PubChem CID 110841024) has the molecular formula C22H19BrCl2N2O and a molecular weight of 478.22 g/mol. Its IUPAC name is N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110841024 |
| Molecular Formula | C22H19BrCl2N2O |
| Molecular Weight | 478.22 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
| SMILES | Cc1ccc(NN=Cc2cc(Br)ccc2OCc2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C22H19BrCl2N2O/c1-14-3-6-19(9-15(14)2)27-26-12-17-11-18(23)5-8-22(17)28-13-16-4-7-20(24)21(25)10-16/h3-12,27H,13H2,1-2H3 |
| InChIKey | UBBHUUDCYIUSIX-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.22 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|