C11H13N7O4 — CID 51682471
3-N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 51682471) has the molecular formula C11H13N7O4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 3-N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 51682471 |
| Molecular Formula | C11H13N7O4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-N-[(E)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | COc1cc(/C=N/Nc2nncn2N)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C11H13N7O4/c1-21-9-4-7(3-8(18(19)20)10(9)22-2)5-13-15-11-16-14-6-17(11)12/h3-6H,12H2,1-2H3,(H,15,16)/b13-5+ |
| InChIKey | RKUOQXONXNMUCH-WLRTZDKTSA-N |
| XLogP | 0.36 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|